CAS 98628-27-4 appears in our catalog under these names: (S)-2-((tert-Butoxycarbonyl)amino)-5-phenylpentanoic acid, 95%, (S)–2–((tert–Butoxycarbonyl)amino)–5–phenylpentanoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 5g, 1g, 250mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoic acid (CAS 98628-27-4) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoic acid. InChIKey: AIFKBFKJMQTYAM-ZDUSSCGKSA-N.
| Molecular formula | C16H23NO4 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoic acid |
| InChIKey | AIFKBFKJMQTYAM-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)