Products 84951-65-5

CAS 84951-65-5 is the registry number for Ropivacaine Impurity 20. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

N-(2,6-dimethylphenyl)pyridine-3-carboxamide (CAS 84951-65-5) is a chemical compound with the molecular formula C14H14N2O and a molecular weight of 226.27 g/mol. IUPAC name: N-(2,6-dimethylphenyl)pyridine-3-carboxamide. InChIKey: JITBOTGCIMNEBT-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14N2O
Molecular weight226.27 g/mol
IUPAC nameN-(2,6-dimethylphenyl)pyridine-3-carboxamide
InChIKeyJITBOTGCIMNEBT-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)C)NC(=O)C2=CN=CC=C2

Computed by PubChem (NCBI)