Products 84955-05-5
CAS 84955-05-5 is the registry number for Cudraxanthone B. Offered by: MedChemExpress. Available pack sizes: Get quote.
5,9,11-trihydroxy-3,3-dimethyl-8-(2-methylbut-3-en-2-yl)pyrano[3,2-a]xanthen-12-one (CAS 84955-05-5) is a chemical compound with the molecular formula C23H22O6 and a molecular weight of 394.4 g/mol. IUPAC name: 5,9,11-trihydroxy-3,3-dimethyl-8-(2-methylbut-3-en-2-yl)pyrano[3,2-a]xanthen-12-one. InChIKey: LGKVKWVNUSOTKD-UHFFFAOYSA-N.
| Molecular formula | C23H22O6 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | 5,9,11-trihydroxy-3,3-dimethyl-8-(2-methylbut-3-en-2-yl)pyrano[3,2-a]xanthen-12-one |
| InChIKey | LGKVKWVNUSOTKD-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C(=CC3=C2C(=O)C4=C(O3)C(=C(C=C4O)O)C(C)(C)C=C)O)C |
Computed by PubChem (NCBI)
Synonyms:
Cudraxanthone B, orb1992482