Products 94513-60-7
CAS 94513-60-7 appears in our catalog under these names: 7–Prenyljacareubin, 7-Prenyljacareubin. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
5,9,10-trihydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)pyrano[3,2-b]xanthen-6-one (CAS 94513-60-7) is a chemical compound with the molecular formula C23H22O6 and a molecular weight of 394.4 g/mol. IUPAC name: 5,9,10-trihydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)pyrano[3,2-b]xanthen-6-one. InChIKey: FKBCRWZDPJSICF-UHFFFAOYSA-N.
| Molecular formula | C23H22O6 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | 5,9,10-trihydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)pyrano[3,2-b]xanthen-6-one |
| InChIKey | FKBCRWZDPJSICF-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=CC2=C(C(=C1O)O)OC3=CC4=C(C=CC(O4)(C)C)C(=C3C2=O)O)C |
Computed by PubChem (NCBI)