CAS 850198-02-6 appears in our catalog under these names: 6–Bromoisoquinolin–5–amine, 6-Bromoisoquinolin-5-amine 95%, 6-Bromoisoquinolin-5-amine, 95%, 6-bromoisoquinolin-5-amine, 95%, 95%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
6-bromoisoquinolin-5-amine (CAS 850198-02-6) is a chemical compound with the molecular formula C9H7BrN2 and a molecular weight of 223.07 g/mol. IUPAC name: 6-bromoisoquinolin-5-amine. InChIKey: TZHVTCQPCFBQGU-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2 |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 6-bromoisoquinolin-5-amine |
| InChIKey | TZHVTCQPCFBQGU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=NC=C2)N)Br |
Computed by PubChem (NCBI)