CAS 850568-54-6 appears in our catalog under these names: (4–(tert–Butoxycarbonyl)phenyl)boronic acid, 4-(tert-Butoxycarbonyl)phenylboronic Acid (contains varying amounts of Anhydride), 4-(TERT-BUTOXYCARBONYL)PHENYLBORONIC ACID, 98%, 98%, (4-(tert-Butoxycarbonyl)phenyl)boronic acid, 99.92%, (4-(tert-Butoxycarbonyl)phenyl)boronic acid, 95%. Offered by: GLPBio, TCI, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 200mg, 1g, 100mg, 250mg, 10g, 25g, 50g.
[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]boronic acid (CAS 850568-54-6) is a chemical compound with the molecular formula C11H15BO4 and a molecular weight of 222.05 g/mol. IUPAC name: [4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]boronic acid. InChIKey: QMVMDYSTJSUDKC-UHFFFAOYSA-N.
| Molecular formula | C11H15BO4 |
|---|---|
| Molecular weight | 222.05 g/mol |
| IUPAC name | [4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]boronic acid |
| InChIKey | QMVMDYSTJSUDKC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)