CAS 850589-56-9 appears in our catalog under these names: 3–Benzyloxy–5–fluorobenzeneboronic acid (contains varying amounts of Anhydride), 3-Benzyloxy-5-fluorophenylboronic acid 97%, 3-Benzyloxy-5-fluorophenylboronic acid, 98%, 98%, 3-Benzyloxy-5-fluorophenylboronic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 100mg, 250mg, 100g, 50g.
(3-fluoro-5-phenylmethoxyphenyl)boronic acid (CAS 850589-56-9) is a chemical compound with the molecular formula C13H12BFO3 and a molecular weight of 246.04 g/mol. IUPAC name: (3-fluoro-5-phenylmethoxyphenyl)boronic acid. InChIKey: QQOFKMPPQQMUDH-UHFFFAOYSA-N.
| Molecular formula | C13H12BFO3 |
|---|---|
| Molecular weight | 246.04 g/mol |
| IUPAC name | (3-fluoro-5-phenylmethoxyphenyl)boronic acid |
| InChIKey | QQOFKMPPQQMUDH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)