CAS 850807-08-8 appears in our catalog under these names: Ethyl 3-amino-5-fluorobenzoate, 95+%, Ethyl 3-amino-5-fluorobenzoate. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g.
Ethyl 3-amino-5-fluorobenzoate (CAS 850807-08-8) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: ethyl 3-amino-5-fluorobenzoate. InChIKey: WWQHGHVXYIMKGU-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | ethyl 3-amino-5-fluorobenzoate |
| InChIKey | WWQHGHVXYIMKGU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=C1)F)N |
Computed by PubChem (NCBI)