CAS 850829-59-3 is the registry number for Valdecoxib Impurity 40. Offered by: Chemat Brand. Available pack sizes: on request.
3-(5-methyl-3-phenyl-1,2-oxazol-4-yl)aniline (CAS 850829-59-3) is a chemical compound with the molecular formula C16H14N2O and a molecular weight of 250.29 g/mol. IUPAC name: 3-(5-methyl-3-phenyl-1,2-oxazol-4-yl)aniline. InChIKey: QKOXLRDYTQIBGW-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 3-(5-methyl-3-phenyl-1,2-oxazol-4-yl)aniline |
| InChIKey | QKOXLRDYTQIBGW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)