Products 850894-19-8
CAS 850894-19-8 is the registry number for Ophioglonol, 99.56%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
Ophioglonol is a hydroxy homoflavonoid that is 2-phenyl-4H-chromen-4-one substituted by hydroxy groups at positions 5, 7, 3' and 4' and a hydroxymethyl group at position 3. It is isolated from the whole plant of Ophioglossum pedunculosum. It has a role as a plant metabolite.
Source: ChEBI
| Molecular formula | C16H12O7 |
|---|---|
| Molecular weight | 316.26 g/mol |
| IUPAC name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-(hydroxymethyl)chromen-4-one |
| InChIKey | NWYYMLNNXGJOKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)CO)O)O |
Computed by PubChem (NCBI)