CAS 851045-51-7 is the registry number for 2-Amino-3-methyl-4-(trifluoromethyl)benzoic acid, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2-amino-3-methyl-4-(trifluoromethyl)benzoic acid (CAS 851045-51-7) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: 2-amino-3-methyl-4-(trifluoromethyl)benzoic acid. InChIKey: VFDUATBWQMJDFP-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | 2-amino-3-methyl-4-(trifluoromethyl)benzoic acid |
| InChIKey | VFDUATBWQMJDFP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1N)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)