Products 851169-53-4
CAS 851169-53-4 is the registry number for 7-Chloro-3-((oxolan-2-yl)methyl)-2-sulfanyl-3,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
7-chloro-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1H-quinazolin-4-one (CAS 851169-53-4) is a chemical compound with the molecular formula C13H13ClN2O2S and a molecular weight of 296.77 g/mol. IUPAC name: 7-chloro-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1H-quinazolin-4-one. InChIKey: PIDANLYQPDAYQQ-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O2S |
|---|---|
| Molecular weight | 296.77 g/mol |
| IUPAC name | 7-chloro-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1H-quinazolin-4-one |
| InChIKey | PIDANLYQPDAYQQ-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)CN2C(=O)C3=C(C=C(C=C3)Cl)NC2=S |
Computed by PubChem (NCBI)