Products 852956-36-6

CAS 852956-36-6 is the registry number for 8-Methoxy-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid (CAS 852956-36-6) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: 5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid. InChIKey: VASJKANHKVOTDC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10O5
Molecular weight210.18 g/mol
IUPAC name5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid
InChIKeyVASJKANHKVOTDC-UHFFFAOYSA-N
SMILESCOC1=CC(=CC2=C1OCCO2)C(=O)O

Computed by PubChem (NCBI)