Products 853077-02-8
CAS 853077-02-8 is the registry number for tert-butyl 4-bromo-7-hydroxy-isoindoline-2-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
Tert-butyl 4-bromo-7-hydroxy-1,3-dihydroisoindole-2-carboxylate (CAS 853077-02-8) is a chemical compound with the molecular formula C13H16BrNO3 and a molecular weight of 314.17 g/mol. IUPAC name: tert-butyl 4-bromo-7-hydroxy-1,3-dihydroisoindole-2-carboxylate. InChIKey: IEXYZXICJFHMQT-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO3 |
|---|---|
| Molecular weight | 314.17 g/mol |
| IUPAC name | tert-butyl 4-bromo-7-hydroxy-1,3-dihydroisoindole-2-carboxylate |
| InChIKey | IEXYZXICJFHMQT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C=CC(=C2C1)Br)O |
Computed by PubChem (NCBI)