CAS 853694-34-5 is the registry number for N-(4-methoxyphenyl)-4-(4-methylpiperidine-1-carbonyl)benzenesulfonamide, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
N-(4-methoxyphenyl)-4-(4-methylpiperidine-1-carbonyl)benzenesulfonamide (CAS 853694-34-5) is a chemical compound with the molecular formula C20H24N2O4S and a molecular weight of 388.5 g/mol. IUPAC name: N-(4-methoxyphenyl)-4-(4-methylpiperidine-1-carbonyl)benzenesulfonamide. InChIKey: CCCOUORAUKBTBH-UHFFFAOYSA-N.
| Molecular formula | C20H24N2O4S |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | N-(4-methoxyphenyl)-4-(4-methylpiperidine-1-carbonyl)benzenesulfonamide |
| InChIKey | CCCOUORAUKBTBH-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)C(=O)C2=CC=C(C=C2)S(=O)(=O)NC3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)