Products 854137-69-2
CAS 854137-69-2 appears in our catalog under these names: 5-(Chloromethyl)-3-(4-ethylphenyl)-1,2,4-oxadiazole, 5-(Chloromethyl)-3-(4-ethylphenyl)-1,2,4-oxadiazole, 95%, 95%, 5-(Chloromethyl)-3-(4-ethylphenyl)-1,2,4-oxadiazole, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 500mg, 1g, 5g, 2.5g.
5-(chloromethyl)-3-(4-ethylphenyl)-1,2,4-oxadiazole (CAS 854137-69-2) is a chemical compound with the molecular formula C11H11ClN2O and a molecular weight of 222.67 g/mol. IUPAC name: 5-(chloromethyl)-3-(4-ethylphenyl)-1,2,4-oxadiazole. InChIKey: MVARJWYCLXBPBU-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O |
|---|---|
| Molecular weight | 222.67 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(4-ethylphenyl)-1,2,4-oxadiazole |
| InChIKey | MVARJWYCLXBPBU-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)