CAS 854181-05-8 is the registry number for 2,2-Dimethyl-1-(4-methylphenyl)propan-1-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2-dimethyl-1-(4-methylphenyl)propan-1-amine (CAS 854181-05-8) is a chemical compound with the molecular formula C12H19N and a molecular weight of 177.29 g/mol. IUPAC name: 2,2-dimethyl-1-(4-methylphenyl)propan-1-amine. InChIKey: XKMYZXWVCDFEJI-UHFFFAOYSA-N.
| Molecular formula | C12H19N |
|---|---|
| Molecular weight | 177.29 g/mol |
| IUPAC name | 2,2-dimethyl-1-(4-methylphenyl)propan-1-amine |
| InChIKey | XKMYZXWVCDFEJI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C(C)(C)C)N |
Computed by PubChem (NCBI)