CAS 854395-96-3 is the registry number for 6,7,8,9-Tetrahydrodibenzo[b,d]furan-4-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
6,7,8,9-tetrahydrodibenzofuran-4-amine;hydrochloride (CAS 854395-96-3) is a chemical compound with the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. IUPAC name: 6,7,8,9-tetrahydrodibenzofuran-4-amine;hydrochloride. InChIKey: KZFHXJPWUVWYJU-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | 6,7,8,9-tetrahydrodibenzofuran-4-amine;hydrochloride |
| InChIKey | KZFHXJPWUVWYJU-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(O2)C(=CC=C3)N.Cl |
Computed by PubChem (NCBI)