Products 855245-73-7
CAS 855245-73-7 appears in our catalog under these names: 3,3′-Dimethyl-4,4′-dinitro-1,1′-biphenyl, 95%, 3,3'-Dimethyl-4,4'-dinitro-1,1'-biphenyl, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-methyl-4-(3-methyl-4-nitrophenyl)-1-nitrobenzene (CAS 855245-73-7) is a chemical compound with the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. IUPAC name: 2-methyl-4-(3-methyl-4-nitrophenyl)-1-nitrobenzene. InChIKey: ZILXPAGTRNWSID-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 2-methyl-4-(3-methyl-4-nitrophenyl)-1-nitrobenzene |
| InChIKey | ZILXPAGTRNWSID-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC(=C(C=C2)[N+](=O)[O-])C)[N+](=O)[O-] |
Computed by PubChem (NCBI)