CAS 855267-50-4 appears in our catalog under these names: 3–(Methylsulfonyl)benzylamine Hydrochloride, 3-(Methylsulfonyl)benzylaminehydrochloride, 3-(Methylsulfonyl)benzylamine Hydrochloride, 96%, 96%, (3-(Methylsulfonyl)phenyl)methanamine hydrochloride, 96%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g, 100mg, 5g, 25g, 10g.
(3-methylsulfonylphenyl)methanamine (CAS 855267-50-4) is a chemical compound with the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. IUPAC name: (3-methylsulfonylphenyl)methanamine. InChIKey: DQFOSYRXEOWKOY-UHFFFAOYSA-N.
| Molecular formula | C8H11NO2S |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | (3-methylsulfonylphenyl)methanamine |
| InChIKey | DQFOSYRXEOWKOY-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)CN |
Computed by PubChem (NCBI)