Products 856256-75-2

CAS 856256-75-2 is the registry number for 5-(2-Phenylethyl)-1H-pyrrole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-(2-phenylethyl)-1H-pyrrole-2-carboxylic acid (CAS 856256-75-2) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 5-(2-phenylethyl)-1H-pyrrole-2-carboxylic acid. InChIKey: XZCFBUOVIPZWHC-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13NO2
Molecular weight215.25 g/mol
IUPAC name5-(2-phenylethyl)-1H-pyrrole-2-carboxylic acid
InChIKeyXZCFBUOVIPZWHC-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CCC2=CC=C(N2)C(=O)O

Computed by PubChem (NCBI)