CAS 856357-86-3 appears in our catalog under these names: 2-(2-Formyl-5-methoxyphenoxy)acetic acid, 95%, 2-(2-formyl-5-methoxyphenoxy)acetic acid, 2-(2-Formyl-5-methoxyphenoxy)acetic acid 95%, 2-(2-Formyl-5-methoxyphenoxy)acetic acid, 95%, 95%, 2-(2-Formyl-5-methoxyphenoxy)acetic acid, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 2,5g, 250mg, 100mg, 1g.
2-(2-formyl-5-methoxyphenoxy)acetic acid (CAS 856357-86-3) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: 2-(2-formyl-5-methoxyphenoxy)acetic acid. InChIKey: SWNDMJNDLFDYQW-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 2-(2-formyl-5-methoxyphenoxy)acetic acid |
| InChIKey | SWNDMJNDLFDYQW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C=O)OCC(=O)O |
Computed by PubChem (NCBI)