CAS 856407-39-1 appears in our catalog under these names: (R)–2,2',3,3'–Tetrahydro–1,1'–spirobi(1H–indene)–7,7'–dicarboxylic Acid, (1R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-dicarboxylic acid, 98% 99%ee, 98% 99%ee, (R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-dicarboxylic acid, 98%, (R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-dicarboxylic acid, 98% 99%ee. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10mg, 50mg, 100mg, 250mg, 1g, 5g.
3,3'-spirobi[1,2-dihydroindene]-4,4'-dicarboxylic acid (CAS 856407-39-1) is a chemical compound with the molecular formula C19H16O4 and a molecular weight of 308.3 g/mol. IUPAC name: 3,3'-spirobi[1,2-dihydroindene]-4,4'-dicarboxylic acid. InChIKey: VKMBXISGZLADKA-UHFFFAOYSA-N.
| Molecular formula | C19H16O4 |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | 3,3'-spirobi[1,2-dihydroindene]-4,4'-dicarboxylic acid |
| InChIKey | VKMBXISGZLADKA-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC3=C2C(=CC=C3)C(=O)O)C4=C1C=CC=C4C(=O)O |
Computed by PubChem (NCBI)