CAS 856905-13-0 appears in our catalog under these names: 3-(Pyrazin-2-yl)benzoic acid, 95%, 3–(Pyrazin–2–yl)benzoic acid, 3-Pyrazin-2-ylbenzoic acid, 3-(Pyrazin-2-yl)benzoic acid, 97%, 97%, 3-Pyrazin-2-ylbenzoic acid, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 0,5g, 100mg.
3-pyrazin-2-ylbenzoic acid (CAS 856905-13-0) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 3-pyrazin-2-ylbenzoic acid. InChIKey: FQEYELBTYMODMC-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 3-pyrazin-2-ylbenzoic acid |
| InChIKey | FQEYELBTYMODMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=NC=CN=C2 |
Computed by PubChem (NCBI)