Products 85699-62-3
CAS 85699-62-3 appears in our catalog under these names: α-Conidendrin, Tsugalactone. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
7-hydroxy-9-(4-hydroxy-3-methoxyphenyl)-6-methoxy-3a,4,9,9a-tetrahydro-1H-benzo[f][2]benzofuran-3-one (CAS 85699-62-3) is a chemical compound with the molecular formula C20H20O6 and a molecular weight of 356.4 g/mol. IUPAC name: 7-hydroxy-9-(4-hydroxy-3-methoxyphenyl)-6-methoxy-3a,4,9,9a-tetrahydro-1H-benzo[f][2]benzofuran-3-one. InChIKey: CAYMSCGTKZIVTN-UHFFFAOYSA-N.
| Molecular formula | C20H20O6 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 7-hydroxy-9-(4-hydroxy-3-methoxyphenyl)-6-methoxy-3a,4,9,9a-tetrahydro-1H-benzo[f][2]benzofuran-3-one |
| InChIKey | CAYMSCGTKZIVTN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(C3COC(=O)C3CC2=C1)C4=CC(=C(C=C4)O)OC)O |
Computed by PubChem (NCBI)