Products 857019-15-9

CAS 857019-15-9 is the registry number for Solifenacin Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-oxo-1-azabicyclo[2.2.2]octane-2-carboxylic acid (CAS 857019-15-9) is a chemical compound with the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. IUPAC name: 3-oxo-1-azabicyclo[2.2.2]octane-2-carboxylic acid. InChIKey: MICTVHDMDPYFKT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11NO3
Molecular weight169.18 g/mol
IUPAC name3-oxo-1-azabicyclo[2.2.2]octane-2-carboxylic acid
InChIKeyMICTVHDMDPYFKT-UHFFFAOYSA-N
SMILESC1CN2CCC1C(=O)C2C(=O)O

Computed by PubChem (NCBI)