Products 857165-45-8
CAS 857165-45-8 appears in our catalog under these names: (3-Chloromethyl-phenyl)-acetic acid, 95%, 2-(3-(Chloromethyl)phenyl)acetic acid, 95%, (3-Chloromethyl-phenyl)acetic acid, 95%. Offered by: Combi-blocks, Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
2-[3-(chloromethyl)phenyl]acetic acid (CAS 857165-45-8) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: 2-[3-(chloromethyl)phenyl]acetic acid. InChIKey: FDDHOTCMBWZKSR-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 2-[3-(chloromethyl)phenyl]acetic acid |
| InChIKey | FDDHOTCMBWZKSR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)CCl)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(3-Chloromethyl-phenyl)-acetic acid, 2-(3-(chloromethyl)phenyl)acetic acid, 2-[3-(chloromethyl)phenyl]acetic Acid, (3-Chloromethyl-phenyl)acetic acid, Benzeneacetic acid,3-(chloromethyl)-, [3-(Chloromethyl)phenyl]acetic acid, 3-(Chloromethyl)benzeneacetic acid, 2-(3-(chloromethyl)phenyl)aceticacid