CAS 857429-62-0 is the registry number for 3-(Aminomethyl)-6-methyl-1,2-dihydropyridin-2-one dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(aminomethyl)-6-methyl-1H-pyridin-2-one;dihydrochloride (CAS 857429-62-0) is a chemical compound with the molecular formula C7H12Cl2N2O and a molecular weight of 211.09 g/mol. IUPAC name: 3-(aminomethyl)-6-methyl-1H-pyridin-2-one;dihydrochloride. InChIKey: RPDRGVCSWMXVQB-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N2O |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | 3-(aminomethyl)-6-methyl-1H-pyridin-2-one;dihydrochloride |
| InChIKey | RPDRGVCSWMXVQB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C(=O)N1)CN.Cl.Cl |
Computed by PubChem (NCBI)