Products 857432-53-2
CAS 857432-53-2 is the registry number for 6-Methyl-3-nitropyridine-2,4-diamine, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-methyl-3-nitropyridine-2,4-diamine (CAS 857432-53-2) is a chemical compound with the molecular formula C6H8N4O2 and a molecular weight of 168.15 g/mol. IUPAC name: 6-methyl-3-nitropyridine-2,4-diamine. InChIKey: MXXMBCJOQDNJKS-UHFFFAOYSA-N.
| Molecular formula | C6H8N4O2 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 6-methyl-3-nitropyridine-2,4-diamine |
| InChIKey | MXXMBCJOQDNJKS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=N1)N)[N+](=O)[O-])N |
Computed by PubChem (NCBI)