Products 857439-68-0
CAS 857439-68-0 is the registry number for N1-(3-Chlorophenyl)benzene-1,2-diamine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-N-(3-chlorophenyl)benzene-1,2-diamine (CAS 857439-68-0) is a chemical compound with the molecular formula C12H11ClN2 and a molecular weight of 218.68 g/mol. IUPAC name: 2-N-(3-chlorophenyl)benzene-1,2-diamine. InChIKey: HRJMRFWIASFQGC-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2 |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | 2-N-(3-chlorophenyl)benzene-1,2-diamine |
| InChIKey | HRJMRFWIASFQGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)NC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)