Products 857599-32-7
CAS 857599-32-7 appears in our catalog under these names: 5-Methoxy-4-methyl-2-nitrobenzoic acid, 95%, 5–Methoxy–4–methyl–2–nitrobenzoic acid, 5-Methoxy-4-methyl-2-nitrobenzoic acid 97%, 5-Methoxy-4-methyl-2-nitrobenzoic acid, 97%, 97%, 5-METHOXY-4-METHYL-2-NITROBENZOIC ACID, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 100mg, 10g.
5-methoxy-4-methyl-2-nitrobenzoic acid (CAS 857599-32-7) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: 5-methoxy-4-methyl-2-nitrobenzoic acid. InChIKey: FDHLDEIOCGPPFW-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 5-methoxy-4-methyl-2-nitrobenzoic acid |
| InChIKey | FDHLDEIOCGPPFW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1OC)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)