CAS 857782-02-6 appears in our catalog under these names: 6-Amino-4,7-dimethylquinolin-2-ol, 6-Amino-4,7-dimethylquinolin-2-ol, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
6-amino-4,7-dimethyl-1H-quinolin-2-one (CAS 857782-02-6) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: 6-amino-4,7-dimethyl-1H-quinolin-2-one. InChIKey: AAUBSEKKJZBCJM-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 6-amino-4,7-dimethyl-1H-quinolin-2-one |
| InChIKey | AAUBSEKKJZBCJM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1N)C(=CC(=O)N2)C |
Computed by PubChem (NCBI)