Products 85819-69-8
CAS 85819-69-8 is the registry number for 8-Methyl-2’-deoxyguanosine. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg, 10 mg.
2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-methyl-1H-purin-6-one (CAS 85819-69-8) is a chemical compound with the molecular formula C11H15N5O4 and a molecular weight of 281.27 g/mol. IUPAC name: 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-methyl-1H-purin-6-one. InChIKey: GXBIHETUJVTBJG-RRKCRQDMSA-N.
| Molecular formula | C11H15N5O4 |
|---|---|
| Molecular weight | 281.27 g/mol |
| IUPAC name | 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-methyl-1H-purin-6-one |
| InChIKey | GXBIHETUJVTBJG-RRKCRQDMSA-N |
| SMILES | CC1=NC2=C(N1[C@H]3C[C@@H]([C@H](O3)CO)O)N=C(NC2=O)N |
Computed by PubChem (NCBI)