CAS 859230-84-5 is the registry number for BMS-505130 (fumarate). Offered by: MedChemExpress. Available pack sizes: Get quote.
(Z)-but-2-enedioic acid;3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1H-indole-5-carbonitrile (CAS 859230-84-5) is a chemical compound with the molecular formula C19H21N3O4 and a molecular weight of 355.4 g/mol. IUPAC name: (Z)-but-2-enedioic acid;3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1H-indole-5-carbonitrile. InChIKey: QYXJWBDKQAIHJM-ZMPXXIOZSA-N.
| Molecular formula | C19H21N3O4 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1H-indole-5-carbonitrile |
| InChIKey | QYXJWBDKQAIHJM-ZMPXXIOZSA-N |
| SMILES | CN(C)C[C@H]1C[C@@H]1C2=CNC3=C2C=C(C=C3)C#N.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)