Products 859744-26-6
CAS 859744-26-6 is the registry number for 3-Sulfanylidene-2,4-diazaspiro(5.5)undec-8-ene-1,5-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-sulfanylidene-2,4-diazaspiro[5.5]undec-9-ene-1,5-dione (CAS 859744-26-6) is a chemical compound with the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. IUPAC name: 3-sulfanylidene-2,4-diazaspiro[5.5]undec-9-ene-1,5-dione. InChIKey: JGOQTNAJWVVNJM-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2S |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | 3-sulfanylidene-2,4-diazaspiro[5.5]undec-9-ene-1,5-dione |
| InChIKey | JGOQTNAJWVVNJM-UHFFFAOYSA-N |
| SMILES | C1CC2(CC=C1)C(=O)NC(=S)NC2=O |
Computed by PubChem (NCBI)