CAS 859854-67-4 is the registry number for Benzyl trans-3-(tert-butoxycarbonylamino)-4-hydroxypiperidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Benzyl (3S,4S)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate (CAS 859854-67-4) is a chemical compound with the molecular formula C18H26N2O5 and a molecular weight of 350.4 g/mol. IUPAC name: benzyl (3S,4S)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate. InChIKey: ZOHDMZDTYNCUBC-GJZGRUSLSA-N.
| Molecular formula | C18H26N2O5 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | benzyl (3S,4S)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate |
| InChIKey | ZOHDMZDTYNCUBC-GJZGRUSLSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CN(CC[C@@H]1O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)