CAS 860533-15-9 is the registry number for 3-Bromo-N,N-dimethyl-2-nitroaniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-bromo-N,N-dimethyl-2-nitroaniline (CAS 860533-15-9) is a chemical compound with the molecular formula C8H9BrN2O2 and a molecular weight of 245.07 g/mol. IUPAC name: 3-bromo-N,N-dimethyl-2-nitroaniline. InChIKey: VSDDRSYPXAIHOM-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN2O2 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 3-bromo-N,N-dimethyl-2-nitroaniline |
| InChIKey | VSDDRSYPXAIHOM-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C(=CC=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)