CAS 860695-64-3 is the registry number for Methyl 3-bromo-5-ethoxybenzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.
Methyl 3-bromo-5-ethoxybenzoate (CAS 860695-64-3) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: methyl 3-bromo-5-ethoxybenzoate. InChIKey: KXRZCRIKLQRDKT-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO3 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | methyl 3-bromo-5-ethoxybenzoate |
| InChIKey | KXRZCRIKLQRDKT-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=CC(=C1)C(=O)OC)Br |
Computed by PubChem (NCBI)