Products 860787-42-4
CAS 860787-42-4 appears in our catalog under these names: 4-Amino-3-bromo-5-methylbenzoic acid, 4-amino-3-bromo-5-methylbenzoic acid, 95%, 4-Amino-3-bromo-5-methylbenzoic acid, 95+%, 4-Amino-3-bromo-5-methylbenzoic acid, ≥99%, ≥99%. Offered by: Fluorochem, Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g.
4-amino-3-bromo-5-methylbenzoic acid (CAS 860787-42-4) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 4-amino-3-bromo-5-methylbenzoic acid. InChIKey: PVGKGOMPWNLCEV-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 4-amino-3-bromo-5-methylbenzoic acid |
| InChIKey | PVGKGOMPWNLCEV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)Br)C(=O)O |
Computed by PubChem (NCBI)