CAS 860788-60-9 is the registry number for N-(3-Ethynylphenyl)-4-methylbenzene-1-sulfonamide, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g.
N-(3-ethynylphenyl)-4-methylbenzenesulfonamide (CAS 860788-60-9) is a chemical compound with the molecular formula C15H13NO2S and a molecular weight of 271.3 g/mol. IUPAC name: N-(3-ethynylphenyl)-4-methylbenzenesulfonamide. InChIKey: NMPJMAWITDKNNJ-UHFFFAOYSA-N.
| Molecular formula | C15H13NO2S |
|---|---|
| Molecular weight | 271.3 g/mol |
| IUPAC name | N-(3-ethynylphenyl)-4-methylbenzenesulfonamide |
| InChIKey | NMPJMAWITDKNNJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC(=C2)C#C |
Computed by PubChem (NCBI)