CAS 861555-59-1 appears in our catalog under these names: 3-Methoxy-2,5-dimethylaniline hydrochloride, 95%, 3-Methoxy-2,5-dimethylaniline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-methoxy-2,5-dimethylaniline;hydrochloride (CAS 861555-59-1) is a chemical compound with the molecular formula C9H14ClNO and a molecular weight of 187.66 g/mol. IUPAC name: 3-methoxy-2,5-dimethylaniline;hydrochloride. InChIKey: HWDAUACVWJIZJY-UHFFFAOYSA-N.
| Molecular formula | C9H14ClNO |
|---|---|
| Molecular weight | 187.66 g/mol |
| IUPAC name | 3-methoxy-2,5-dimethylaniline;hydrochloride |
| InChIKey | HWDAUACVWJIZJY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)OC)C)N.Cl |
Computed by PubChem (NCBI)