Products 861792-46-3

CAS 861792-46-3 is the registry number for 4-Methoxy-3-methyl-5-nitrobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

4-methoxy-3-methyl-5-nitrobenzoic acid (CAS 861792-46-3) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: 4-methoxy-3-methyl-5-nitrobenzoic acid. InChIKey: AHVHWBJKSKTEBI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9NO5
Molecular weight211.17 g/mol
IUPAC name4-methoxy-3-methyl-5-nitrobenzoic acid
InChIKeyAHVHWBJKSKTEBI-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1OC)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)