Products 861797-07-1
CAS 861797-07-1 is the registry number for 4-Amino-2-bromophenoxyacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(4-amino-2-bromophenoxy)acetic acid (CAS 861797-07-1) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 2-(4-amino-2-bromophenoxy)acetic acid. InChIKey: HGMQTGLZRRVNHQ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 2-(4-amino-2-bromophenoxy)acetic acid |
| InChIKey | HGMQTGLZRRVNHQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)Br)OCC(=O)O |
Computed by PubChem (NCBI)