CAS 861965-54-0 is the registry number for 2-(4-Cyclopentylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-(4-cyclopentylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 861965-54-0) is a chemical compound with the molecular formula C17H25BO2 and a molecular weight of 272.2 g/mol. IUPAC name: 2-(4-cyclopentylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LVOIIZCFKHGMRA-UHFFFAOYSA-N.
| Molecular formula | C17H25BO2 |
|---|---|
| Molecular weight | 272.2 g/mol |
| IUPAC name | 2-(4-cyclopentylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LVOIIZCFKHGMRA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3CCCC3 |
Computed by PubChem (NCBI)