Products 861968-02-7
CAS 861968-02-7 is the registry number for FLDP-8. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3E,5E)-3,5-bis[(4-hydroxy-3-methoxyphenyl)methylidene]-1-methylpiperidin-4-one (CAS 861968-02-7) is a chemical compound with the molecular formula C22H23NO5 and a molecular weight of 381.4 g/mol. IUPAC name: (3E,5E)-3,5-bis[(4-hydroxy-3-methoxyphenyl)methylidene]-1-methylpiperidin-4-one. InChIKey: ZQRGLBNADQCTRG-GONBZBRSSA-N.
| Molecular formula | C22H23NO5 |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | (3E,5E)-3,5-bis[(4-hydroxy-3-methoxyphenyl)methylidene]-1-methylpiperidin-4-one |
| InChIKey | ZQRGLBNADQCTRG-GONBZBRSSA-N |
| SMILES | CN1C/C(=C\C2=CC(=C(C=C2)O)OC)/C(=O)/C(=C/C3=CC(=C(C=C3)O)OC)/C1 |
Computed by PubChem (NCBI)