CAS 862494-59-5 appears in our catalog under these names: 5–Phenylthiazole–2–carbaldehyde, 5-Phenyl-1,3-thiazole-2-carbaldehyde. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 2,5g, 250mg.
5-phenyl-1,3-thiazole-2-carbaldehyde (CAS 862494-59-5) is a chemical compound with the molecular formula C10H7NOS and a molecular weight of 189.24 g/mol. IUPAC name: 5-phenyl-1,3-thiazole-2-carbaldehyde. InChIKey: KOEXIFWBDMYROV-UHFFFAOYSA-N.
| Molecular formula | C10H7NOS |
|---|---|
| Molecular weight | 189.24 g/mol |
| IUPAC name | 5-phenyl-1,3-thiazole-2-carbaldehyde |
| InChIKey | KOEXIFWBDMYROV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(S2)C=O |
Computed by PubChem (NCBI)