CAS 862647-09-4 is the registry number for (R)-2-Benzhydryloxirane, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(2R)-2-benzhydryloxirane (CAS 862647-09-4) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: (2R)-2-benzhydryloxirane. InChIKey: QEZITUGLJWMLCF-AWEZNQCLSA-N.
| Molecular formula | C15H14O |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | (2R)-2-benzhydryloxirane |
| InChIKey | QEZITUGLJWMLCF-AWEZNQCLSA-N |
| SMILES | C1[C@H](O1)C(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)