CAS 863668-02-4 is the registry number for 2-(5,7-Dimethyl-2-(methylsulfanyl)-(1,2,4)triazolo(1,5-a)pyrimidin-6-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetic acid (CAS 863668-02-4) is a chemical compound with the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. IUPAC name: 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetic acid. InChIKey: AFWKTHVGDRIPLU-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2S |
|---|---|
| Molecular weight | 252.30 g/mol |
| IUPAC name | 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetic acid |
| InChIKey | AFWKTHVGDRIPLU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC2=NC(=NN12)SC)C)CC(=O)O |
Computed by PubChem (NCBI)