CAS 863669-01-6 appears in our catalog under these names: 3-(Benzo(d)thiazol-2-yl)-2-methyl-2-phenylpropanoic acid, 97%, 3-(Benzo[d]thiazol-2-yl)-2-methyl-2-phenylpropanoic acid, 95%, 95%, 3-(1,3-Benzothiazol-2-yl)-2-methyl-2-phenylpropanoic acid, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
3-(1,3-benzothiazol-2-yl)-2-methyl-2-phenylpropanoic acid (CAS 863669-01-6) is a chemical compound with the molecular formula C17H15NO2S and a molecular weight of 297.4 g/mol. IUPAC name: 3-(1,3-benzothiazol-2-yl)-2-methyl-2-phenylpropanoic acid. InChIKey: CQYXWVCTRPQMKH-UHFFFAOYSA-N.
| Molecular formula | C17H15NO2S |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | 3-(1,3-benzothiazol-2-yl)-2-methyl-2-phenylpropanoic acid |
| InChIKey | CQYXWVCTRPQMKH-UHFFFAOYSA-N |
| SMILES | CC(CC1=NC2=CC=CC=C2S1)(C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)