CAS 863868-31-9 is the registry number for 2-(4-Bromo-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 863868-31-9) is a chemical compound with the molecular formula C13H15BBrNO2 and a molecular weight of 307.98 g/mol. IUPAC name: 4-bromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: NZFROIWRZNAQLI-UHFFFAOYSA-N.
| Molecular formula | C13H15BBrNO2 |
|---|---|
| Molecular weight | 307.98 g/mol |
| IUPAC name | 4-bromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | NZFROIWRZNAQLI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C#N)Br |
Computed by PubChem (NCBI)